C10H10ClF3N2 — CID 171248192
(1S)-2,2,2-trifluoro-1-(1H-indol-6-yl)ethanamine;hydrochloride (PubChem CID 171248192) has the molecular formula C10H10ClF3N2 and a molecular weight of 250.65 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-(1H-indol-6-yl)ethanamine;hydrochloride.
| Compound Name | (1S)-2,2,2-trifluoro-1-(1H-indol-6-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171248192 |
| Molecular Formula | C10H10ClF3N2 |
| Molecular Weight | 250.65 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-(1H-indol-6-yl)ethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc2cc[nH]c2c1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2.ClH/c11-10(12,13)9(14)7-2-1-6-3-4-15-8(6)5-7;/h1-5,9,15H,14H2;1H/t9-;/m0./s1 |
| InChIKey | QGEMGOHTHDXGSM-FVGYRXGTSA-N |
| XLogP | 3.15 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |