C13H16F3NOSi — CID 59468735
trimethyl-[2,2,2-trifluoro-1-(1H-indol-6-yl)ethoxy]silane (PubChem CID 59468735) has the molecular formula C13H16F3NOSi and a molecular weight of 287.36 g/mol. Its IUPAC name is trimethyl-[2,2,2-trifluoro-1-(1H-indol-6-yl)ethoxy]silane.
| Compound Name | trimethyl-[2,2,2-trifluoro-1-(1H-indol-6-yl)ethoxy]silane |
|---|---|
| PubChem CID | 59468735 |
| Molecular Formula | C13H16F3NOSi |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | trimethyl-[2,2,2-trifluoro-1-(1H-indol-6-yl)ethoxy]silane |
| SMILES | C[Si](C)(C)OC(c1ccc2cc[nH]c2c1)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NOSi/c1-19(2,3)18-12(13(14,15)16)10-5-4-9-6-7-17-11(9)8-10/h4-8,12,17H,1-3H3 |
| InChIKey | JJKJFCFETICDRK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|