C11H10ClF5N2 — CID 171312375
(1R)-2,2,3,3,3-pentafluoro-1-(1H-indol-6-yl)propan-1-amine;hydrochloride (PubChem CID 171312375) has the molecular formula C11H10ClF5N2 and a molecular weight of 300.66 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-(1H-indol-6-yl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-(1H-indol-6-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312375 |
| Molecular Formula | C11H10ClF5N2 |
| Molecular Weight | 300.66 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-(1H-indol-6-yl)propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc2cc[nH]c2c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F5N2.ClH/c12-10(13,11(14,15)16)9(17)7-2-1-6-3-4-18-8(6)5-7;/h1-5,9,18H,17H2;1H/t9-;/m1./s1 |
| InChIKey | QAMDDKGLPXQRQC-SBSPUUFOSA-N |
| XLogP | 3.79 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|