C13H10F5N — CID 171311499
(1S)-2,2,3,3,3-pentafluoro-1-naphthalen-2-ylpropan-1-amine (PubChem CID 171311499) has the molecular formula C13H10F5N and a molecular weight of 275.22 g/mol. Its IUPAC name is (1S)-2,2,3,3,3-pentafluoro-1-naphthalen-2-ylpropan-1-amine.
| Compound Name | (1S)-2,2,3,3,3-pentafluoro-1-naphthalen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 171311499 |
| Molecular Formula | C13H10F5N |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (1S)-2,2,3,3,3-pentafluoro-1-naphthalen-2-ylpropan-1-amine |
| SMILES | N[C@@H](c1ccc2ccccc2c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F5N/c14-12(15,13(16,17)18)11(19)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H,19H2/t11-/m0/s1 |
| InChIKey | QESDZDGQODLPOB-NSHDSACASA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|