C15H13ClF5N — CID 171312478
(1R)-2,2,3,3,3-pentafluoro-1-(4-phenylphenyl)propan-1-amine;hydrochloride (PubChem CID 171312478) has the molecular formula C15H13ClF5N and a molecular weight of 337.72 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-(4-phenylphenyl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-(4-phenylphenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312478 |
| Molecular Formula | C15H13ClF5N |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-(4-phenylphenyl)propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc(-c2ccccc2)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H12F5N.ClH/c16-14(17,15(18,19)20)13(21)12-8-6-11(7-9-12)10-4-2-1-3-5-10;/h1-9,13H,21H2;1H/t13-;/m1./s1 |
| InChIKey | FPOKXAOBXBEKBV-BTQNPOSSSA-N |
| XLogP | 4.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|