C15H14F3N — CID 121467476
3,3,3-trifluoro-2-(4-phenylphenyl)propan-1-amine (PubChem CID 121467476) has the molecular formula C15H14F3N and a molecular weight of 265.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(4-phenylphenyl)propan-1-amine.
| Compound Name | 3,3,3-trifluoro-2-(4-phenylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 121467476 |
| Molecular Formula | C15H14F3N |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3,3,3-trifluoro-2-(4-phenylphenyl)propan-1-amine |
| SMILES | NCC(c1ccc(-c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H14F3N/c16-15(17,18)14(10-19)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14H,10,19H2 |
| InChIKey | LJMRPAXVZDPPJH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |