C20H27NO — CID 121454673
6-amino-4,4-dimethyl-5-(4-phenylphenyl)hexan-2-ol (PubChem CID 121454673) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 6-amino-4,4-dimethyl-5-(4-phenylphenyl)hexan-2-ol.
| Compound Name | 6-amino-4,4-dimethyl-5-(4-phenylphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 121454673 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 6-amino-4,4-dimethyl-5-(4-phenylphenyl)hexan-2-ol |
| SMILES | CC(O)CC(C)(C)C(CN)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H27NO/c1-15(22)13-20(2,3)19(14-21)18-11-9-17(10-12-18)16-7-5-4-6-8-16/h4-12,15,19,22H,13-14,21H2,1-3H3 |
| InChIKey | WFSWQNOYIXLQRZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |