C9H9ClF3N — CID 96707876
(2R)-2-(3-chlorophenyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 96707876) has the molecular formula C9H9ClF3N and a molecular weight of 223.63 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenyl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | (2R)-2-(3-chlorophenyl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 96707876 |
| Molecular Formula | C9H9ClF3N |
| Molecular Weight | 223.63 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | (2R)-2-(3-chlorophenyl)-3,3,3-trifluoropropan-1-amine |
| SMILES | NC[C@@H](c1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C9H9ClF3N/c10-7-3-1-2-6(4-7)8(5-14)9(11,12)13/h1-4,8H,5,14H2/t8-/m0/s1 |
| InChIKey | SVEZKQHPNLRCEG-QMMMGPOBSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |