C10H11ClF3NO — CID 171237874
(1R,3R)-3-amino-1-(3-chlorophenyl)-4,4,4-trifluorobutan-1-ol (PubChem CID 171237874) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is (1R,3R)-3-amino-1-(3-chlorophenyl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | (1R,3R)-3-amino-1-(3-chlorophenyl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 171237874 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (1R,3R)-3-amino-1-(3-chlorophenyl)-4,4,4-trifluorobutan-1-ol |
| SMILES | N[C@H](C[C@@H](O)c1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H11ClF3NO/c11-7-3-1-2-6(4-7)8(16)5-9(15)10(12,13)14/h1-4,8-9,16H,5,15H2/t8-,9-/m1/s1 |
| InChIKey | CNEXHRGSNKWPCF-RKDXNWHRSA-N |
| XLogP | 2.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |