C10H13ClF3NO — CID 171237918
(1R,3R)-3-amino-4,4,4-trifluoro-1-phenylbutan-1-ol;hydrochloride (PubChem CID 171237918) has the molecular formula C10H13ClF3NO and a molecular weight of 255.67 g/mol. Its IUPAC name is (1R,3R)-3-amino-4,4,4-trifluoro-1-phenylbutan-1-ol;hydrochloride.
| Compound Name | (1R,3R)-3-amino-4,4,4-trifluoro-1-phenylbutan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171237918 |
| Molecular Formula | C10H13ClF3NO |
| Molecular Weight | 255.67 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (1R,3R)-3-amino-4,4,4-trifluoro-1-phenylbutan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](C[C@@H](O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO.ClH/c11-10(12,13)9(14)6-8(15)7-4-2-1-3-5-7;/h1-5,8-9,15H,6,14H2;1H/t8-,9-;/m1./s1 |
| InChIKey | UXNKXRLTDIDBJD-VTLYIQCISA-N |
| XLogP | 2.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |