C11H8ClF7O — CID 156763405
1-(3-chlorophenyl)-3,3,4,4,5,5,5-heptafluoropentan-1-ol (PubChem CID 156763405) has the molecular formula C11H8ClF7O and a molecular weight of 324.62 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3,3,4,4,5,5,5-heptafluoropentan-1-ol.
| Compound Name | 1-(3-chlorophenyl)-3,3,4,4,5,5,5-heptafluoropentan-1-ol |
|---|---|
| PubChem CID | 156763405 |
| Molecular Formula | C11H8ClF7O |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 1-(3-chlorophenyl)-3,3,4,4,5,5,5-heptafluoropentan-1-ol |
| SMILES | OC(CC(F)(F)C(F)(F)C(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H8ClF7O/c12-7-3-1-2-6(4-7)8(20)5-9(13,14)10(15,16)11(17,18)19/h1-4,8,20H,5H2 |
| InChIKey | GUTWZPBMQZTTCF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|