C16H13F13O — CID 156763031
1-(3-ethylphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol (PubChem CID 156763031) has the molecular formula C16H13F13O and a molecular weight of 468.25 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol.
| Compound Name | 1-(3-ethylphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol |
|---|---|
| PubChem CID | 156763031 |
| Molecular Formula | C16H13F13O |
| Molecular Weight | 468.25 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 1-(3-ethylphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol |
| SMILES | CCc1cccc(C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F13O/c1-2-8-4-3-5-9(6-8)10(30)7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h3-6,10,30H,2,7H2,1H3 |
| InChIKey | WFIBEEAWPVOHBR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.25 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|