C19H15F17O — CID 156765829
1-ethyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methoxydecyl)benzene (PubChem CID 156765829) has the molecular formula C19H15F17O and a molecular weight of 582.29 g/mol. Its IUPAC name is 1-ethyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methoxydecyl)benzene.
| Compound Name | 1-ethyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methoxydecyl)benzene |
|---|---|
| PubChem CID | 156765829 |
| Molecular Formula | C19H15F17O |
| Molecular Weight | 582.29 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | 1-ethyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methoxydecyl)benzene |
| SMILES | CCc1cccc(C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC)c1 |
| InChI | InChI=1S/C19H15F17O/c1-3-9-5-4-6-10(7-9)11(37-2)8-12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36/h4-7,11H,3,8H2,1-2H3 |
| InChIKey | NDAKCVALVRDGRP-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.29 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|