C20H19F15O — CID 156764892
1-butyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-methoxynonyl)benzene (PubChem CID 156764892) has the molecular formula C20H19F15O and a molecular weight of 560.34 g/mol. Its IUPAC name is 1-butyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-methoxynonyl)benzene.
| Compound Name | 1-butyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-methoxynonyl)benzene |
|---|---|
| PubChem CID | 156764892 |
| Molecular Formula | C20H19F15O |
| Molecular Weight | 560.34 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 1-butyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-methoxynonyl)benzene |
| SMILES | CCCCc1ccc(C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC)cc1 |
| InChI | InChI=1S/C20H19F15O/c1-3-4-5-11-6-8-12(9-7-11)13(36-2)10-14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)35/h6-9,13H,3-5,10H2,1-2H3 |
| InChIKey | JQELSBZYNJKPDT-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.34 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|