C17H19F9O — CID 156764295
1-butyl-3-(3,3,4,4,5,5,6,6,6-nonafluoro-1-methoxyhexyl)benzene (PubChem CID 156764295) has the molecular formula C17H19F9O and a molecular weight of 410.32 g/mol. Its IUPAC name is 1-butyl-3-(3,3,4,4,5,5,6,6,6-nonafluoro-1-methoxyhexyl)benzene.
| Compound Name | 1-butyl-3-(3,3,4,4,5,5,6,6,6-nonafluoro-1-methoxyhexyl)benzene |
|---|---|
| PubChem CID | 156764295 |
| Molecular Formula | C17H19F9O |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1-butyl-3-(3,3,4,4,5,5,6,6,6-nonafluoro-1-methoxyhexyl)benzene |
| SMILES | CCCCc1cccc(C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC)c1 |
| InChI | InChI=1S/C17H19F9O/c1-3-4-6-11-7-5-8-12(9-11)13(27-2)10-14(18,19)15(20,21)16(22,23)17(24,25)26/h5,7-9,13H,3-4,6,10H2,1-2H3 |
| InChIKey | FJMFKRGFDSQTCO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|