C16H15F11O2 — CID 156764273
1-ethoxy-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene (PubChem CID 156764273) has the molecular formula C16H15F11O2 and a molecular weight of 448.27 g/mol. Its IUPAC name is 1-ethoxy-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene.
| Compound Name | 1-ethoxy-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene |
|---|---|
| PubChem CID | 156764273 |
| Molecular Formula | C16H15F11O2 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1-ethoxy-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene |
| SMILES | CCOc1cccc(C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC)c1 |
| InChI | InChI=1S/C16H15F11O2/c1-3-29-10-6-4-5-9(7-10)11(28-2)8-12(17,18)13(19,20)14(21,22)15(23,24)16(25,26)27/h4-7,11H,3,8H2,1-2H3 |
| InChIKey | CIBBEYLGXLFHTH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|