C14H17F5O2 — CID 156763112
1-(3,3,4,4,4-pentafluoro-1-methoxybutyl)-3-propan-2-yloxybenzene (PubChem CID 156763112) has the molecular formula C14H17F5O2 and a molecular weight of 312.28 g/mol. Its IUPAC name is 1-(3,3,4,4,4-pentafluoro-1-methoxybutyl)-3-propan-2-yloxybenzene.
| Compound Name | 1-(3,3,4,4,4-pentafluoro-1-methoxybutyl)-3-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 156763112 |
| Molecular Formula | C14H17F5O2 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-(3,3,4,4,4-pentafluoro-1-methoxybutyl)-3-propan-2-yloxybenzene |
| SMILES | COC(CC(F)(F)C(F)(F)F)c1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C14H17F5O2/c1-9(2)21-11-6-4-5-10(7-11)12(20-3)8-13(15,16)14(17,18)19/h4-7,9,12H,8H2,1-3H3 |
| InChIKey | YKSIGKQDOVWKLF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|