C12H13F5O2 — CID 156765103
1-methoxy-3-(3,3,4,4,4-pentafluoro-1-methoxybutyl)benzene (PubChem CID 156765103) has the molecular formula C12H13F5O2 and a molecular weight of 284.22 g/mol. Its IUPAC name is 1-methoxy-3-(3,3,4,4,4-pentafluoro-1-methoxybutyl)benzene.
| Compound Name | 1-methoxy-3-(3,3,4,4,4-pentafluoro-1-methoxybutyl)benzene |
|---|---|
| PubChem CID | 156765103 |
| Molecular Formula | C12H13F5O2 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-methoxy-3-(3,3,4,4,4-pentafluoro-1-methoxybutyl)benzene |
| SMILES | COc1cccc(C(CC(F)(F)C(F)(F)F)OC)c1 |
| InChI | InChI=1S/C12H13F5O2/c1-18-9-5-3-4-8(6-9)10(19-2)7-11(13,14)12(15,16)17/h3-6,10H,7H2,1-2H3 |
| InChIKey | UQQLVRVSFGBGCD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|