C17H13F13O3 — CID 156765080
[3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)phenyl] acetate (PubChem CID 156765080) has the molecular formula C17H13F13O3 and a molecular weight of 512.26 g/mol. Its IUPAC name is [3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)phenyl] acetate.
| Compound Name | [3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)phenyl] acetate |
|---|---|
| PubChem CID | 156765080 |
| Molecular Formula | C17H13F13O3 |
| Molecular Weight | 512.26 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | [3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-methoxyoctyl)phenyl] acetate |
| SMILES | COC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C17H13F13O3/c1-8(31)33-10-5-3-4-9(6-10)11(32-2)7-12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h3-6,11H,7H2,1-2H3 |
| InChIKey | SFTKKGXYWWIFCJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.26 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|