C20H15F11O — CID 156764119
1-phenyl-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene (PubChem CID 156764119) has the molecular formula C20H15F11O and a molecular weight of 480.32 g/mol. Its IUPAC name is 1-phenyl-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene.
| Compound Name | 1-phenyl-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene |
|---|---|
| PubChem CID | 156764119 |
| Molecular Formula | C20H15F11O |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 1-phenyl-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene |
| SMILES | COC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H15F11O/c1-32-15(14-9-5-8-13(10-14)12-6-3-2-4-7-12)11-16(21,22)17(23,24)18(25,26)19(27,28)20(29,30)31/h2-10,15H,11H2,1H3 |
| InChIKey | RKMFJMDGBCKURB-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|