C15H13F11O — CID 156763110
1-methyl-2-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene (PubChem CID 156763110) has the molecular formula C15H13F11O and a molecular weight of 418.25 g/mol. Its IUPAC name is 1-methyl-2-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene.
| Compound Name | 1-methyl-2-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene |
|---|---|
| PubChem CID | 156763110 |
| Molecular Formula | C15H13F11O |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1-methyl-2-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene |
| SMILES | COC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1C |
| InChI | InChI=1S/C15H13F11O/c1-8-5-3-4-6-9(8)10(27-2)7-11(16,17)12(18,19)13(20,21)14(22,23)15(24,25)26/h3-6,10H,7H2,1-2H3 |
| InChIKey | XYHDZVDECUWRDE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|