C18H19F11O — CID 156763827
1-butan-2-yl-2-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene (PubChem CID 156763827) has the molecular formula C18H19F11O and a molecular weight of 460.33 g/mol. Its IUPAC name is 1-butan-2-yl-2-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene.
| Compound Name | 1-butan-2-yl-2-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene |
|---|---|
| PubChem CID | 156763827 |
| Molecular Formula | C18H19F11O |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 1-butan-2-yl-2-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-methoxyheptyl)benzene |
| SMILES | CCC(C)c1ccccc1C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C18H19F11O/c1-4-10(2)11-7-5-6-8-12(11)13(30-3)9-14(19,20)15(21,22)16(23,24)17(25,26)18(27,28)29/h5-8,10,13H,4,9H2,1-3H3 |
| InChIKey | UJTMPZGJXDCADO-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|