C19H16F16O — CID 162348309
2-(2-butan-2-ylphenyl)-1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluorononan-2-ol (PubChem CID 162348309) has the molecular formula C19H16F16O and a molecular weight of 564.30 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenyl)-1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluorononan-2-ol.
| Compound Name | 2-(2-butan-2-ylphenyl)-1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluorononan-2-ol |
|---|---|
| PubChem CID | 162348309 |
| Molecular Formula | C19H16F16O |
| Molecular Weight | 564.30 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | 2-(2-butan-2-ylphenyl)-1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluorononan-2-ol |
| SMILES | CCC(C)c1ccccc1C(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H16F16O/c1-3-9(2)10-6-4-5-7-11(10)12(36,18(30,31)32)8-13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)19(33,34)35/h4-7,9,36H,3,8H2,1-2H3 |
| InChIKey | WRIBTSGJQFOHPO-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.30 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|