C13H12F8O — CID 23528254
2-(4-butan-2-yl-2,3-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 23528254) has the molecular formula C13H12F8O and a molecular weight of 336.22 g/mol. Its IUPAC name is 2-(4-butan-2-yl-2,3-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(4-butan-2-yl-2,3-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 23528254 |
| Molecular Formula | C13H12F8O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-(4-butan-2-yl-2,3-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H12F8O/c1-3-6(2)7-4-5-8(10(15)9(7)14)11(22,12(16,17)18)13(19,20)21/h4-6,22H,3H2,1-2H3 |
| InChIKey | NETWRVWJCXURPS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |