C30H24F24O2 — CID 91540539
2-[4-butan-2-yl-2,3-bis(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2-[4-butan-2-yl-2,6-bis(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 91540539) has the molecular formula C30H24F24O2 and a molecular weight of 872.47 g/mol. Its IUPAC name is 2-[4-butan-2-yl-2,3-bis(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2-[4-butan-2-yl-2,6-bis(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-butan-2-yl-2,3-bis(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2-[4-butan-2-yl-2,6-bis(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 91540539 |
| Molecular Formula | C30H24F24O2 |
| Molecular Weight | 872.47 g/mol |
| Exact Mass | 872.14 |
| IUPAC Name | 2-[4-butan-2-yl-2,3-bis(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2-[4-butan-2-yl-2,6-bis(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)c1cc(C(F)(F)F)c(C(O)(C(F)(F)F)C(F)(F)F)c(C(F)(F)F)c1.CCC(C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/2C15H12F12O/c1-3-6(2)7-4-8(12(16,17)18)10(9(5-7)13(19,20)21)11(28,14(22,23)24)15(25,26)27;1-3-6(2)7-4-5-8(11(28,14(22,23)24)15(25,26)27)10(13(19,20)21)9(7)12(16,17)18/h2*4-6,28H,3H2,1-2H3 |
| InChIKey | PMUPXJFEHFWFST-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.47 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |