C16H14F12 — CID 20770048
5-butan-2-yl-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,3-bis(trifluoromethyl)benzene (PubChem CID 20770048) has the molecular formula C16H14F12 and a molecular weight of 434.26 g/mol. Its IUPAC name is 5-butan-2-yl-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,3-bis(trifluoromethyl)benzene.
| Compound Name | 5-butan-2-yl-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20770048 |
| Molecular Formula | C16H14F12 |
| Molecular Weight | 434.26 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 5-butan-2-yl-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,3-bis(trifluoromethyl)benzene |
| SMILES | CCC(C)c1cc(C(F)(F)F)c(C(C)(C(F)(F)F)C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F12/c1-4-7(2)8-5-9(13(17,18)19)11(10(6-8)14(20,21)22)12(3,15(23,24)25)16(26,27)28/h5-7H,4H2,1-3H3 |
| InChIKey | JNNKMESAAAZJRH-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.26 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |