C17H25F3N2 — CID 152876391
1-[[4-butan-2-yl-2-(trifluoromethyl)phenyl]methyl]-4-methylpiperazine (PubChem CID 152876391) has the molecular formula C17H25F3N2 and a molecular weight of 314.40 g/mol. Its IUPAC name is 1-[[4-butan-2-yl-2-(trifluoromethyl)phenyl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[4-butan-2-yl-2-(trifluoromethyl)phenyl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 152876391 |
| Molecular Formula | C17H25F3N2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-[[4-butan-2-yl-2-(trifluoromethyl)phenyl]methyl]-4-methylpiperazine |
| SMILES | CCC(C)c1ccc(CN2CCN(C)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H25F3N2/c1-4-13(2)14-5-6-15(16(11-14)17(18,19)20)12-22-9-7-21(3)8-10-22/h5-6,11,13H,4,7-10,12H2,1-3H3 |
| InChIKey | UAMVKIKGRBODSN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |