C16H24F3N3O — CID 162434874
N-methoxy-4-[(4-propylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline (PubChem CID 162434874) has the molecular formula C16H24F3N3O and a molecular weight of 331.38 g/mol. Its IUPAC name is N-methoxy-4-[(4-propylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline.
| Compound Name | N-methoxy-4-[(4-propylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 162434874 |
| Molecular Formula | C16H24F3N3O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-methoxy-4-[(4-propylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline |
| SMILES | CCCN1CCN(Cc2ccc(NOC)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H24F3N3O/c1-3-6-21-7-9-22(10-8-21)12-13-4-5-14(20-23-2)11-15(13)16(17,18)19/h4-5,11,20H,3,6-10,12H2,1-2H3 |
| InChIKey | IUAOEZWHZQGCHR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|