C17H24F3N3 — CID 162601886
1-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-N-methylethenamine (PubChem CID 162601886) has the molecular formula C17H24F3N3 and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-N-methylethenamine.
| Compound Name | 1-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-N-methylethenamine |
|---|---|
| PubChem CID | 162601886 |
| Molecular Formula | C17H24F3N3 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-N-methylethenamine |
| SMILES | C=C(NC)c1ccc(CN2CCN(CC)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3N3/c1-4-22-7-9-23(10-8-22)12-15-6-5-14(13(2)21-3)11-16(15)17(18,19)20/h5-6,11,21H,2,4,7-10,12H2,1,3H3 |
| InChIKey | MIZGYEVKSDKJDP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |