C22H25F3N4O3 — CID 59346396
N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-4-methyl-3-nitrobenzamide (PubChem CID 59346396) has the molecular formula C22H25F3N4O3 and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 59346396 |
| Molecular Formula | C22H25F3N4O3 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCN1CCN(Cc2ccc(NC(=O)c3ccc(C)c([N+](=O)[O-])c3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H25F3N4O3/c1-3-27-8-10-28(11-9-27)14-17-6-7-18(13-19(17)22(23,24)25)26-21(30)16-5-4-15(2)20(12-16)29(31)32/h4-7,12-13H,3,8-11,14H2,1-2H3,(H,26,30) |
| InChIKey | PKUOMVSWYHIWJG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|