C16H12BrF3N2O3 — CID 146622032
4-(bromomethyl)-N-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)benzamide (PubChem CID 146622032) has the molecular formula C16H12BrF3N2O3 and a molecular weight of 417.18 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-(bromomethyl)-N-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 146622032 |
| Molecular Formula | C16H12BrF3N2O3 |
| Molecular Weight | 417.18 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 4-(bromomethyl)-N-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CBr)c(C(F)(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12BrF3N2O3/c1-9-2-5-12(7-14(9)22(24)25)21-15(23)10-3-4-11(8-17)13(6-10)16(18,19)20/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | KVWGJVKETMONGF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.18 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|