C25H29F3N3O2P — CID 86632313
N-[4-[[4-(dimethylphosphorylmethyl)piperazin-1-yl]methyl]-3-(trifluoromethyl)phenyl]-3-ethynyl-4-methylbenzamide (PubChem CID 86632313) has the molecular formula C25H29F3N3O2P and a molecular weight of 491.49 g/mol. Its IUPAC name is N-[4-[[4-(dimethylphosphorylmethyl)piperazin-1-yl]methyl]-3-(trifluoromethyl)phenyl]-3-ethynyl-4-methylbenzamide.
| Compound Name | N-[4-[[4-(dimethylphosphorylmethyl)piperazin-1-yl]methyl]-3-(trifluoromethyl)phenyl]-3-ethynyl-4-methylbenzamide |
|---|---|
| PubChem CID | 86632313 |
| Molecular Formula | C25H29F3N3O2P |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[4-[[4-(dimethylphosphorylmethyl)piperazin-1-yl]methyl]-3-(trifluoromethyl)phenyl]-3-ethynyl-4-methylbenzamide |
| SMILES | C#Cc1cc(C(=O)Nc2ccc(CN3CCN(CP(C)(C)=O)CC3)c(C(F)(F)F)c2)ccc1C |
| InChI | InChI=1S/C25H29F3N3O2P/c1-5-19-14-20(7-6-18(19)2)24(32)29-22-9-8-21(23(15-22)25(26,27)28)16-30-10-12-31(13-11-30)17-34(3,4)33/h1,6-9,14-15H,10-13,16-17H2,2-4H3,(H,29,32) |
| InChIKey | MACOUPORMJRBDR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|