C25H29F3IN3O3 — CID 46839045
tert-butyl 4-[[4-[(3-iodo-4-methylbenzoyl)amino]-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 46839045) has the molecular formula C25H29F3IN3O3 and a molecular weight of 603.42 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(3-iodo-4-methylbenzoyl)amino]-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[(3-iodo-4-methylbenzoyl)amino]-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46839045 |
| Molecular Formula | C25H29F3IN3O3 |
| Molecular Weight | 603.42 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | tert-butyl 4-[[4-[(3-iodo-4-methylbenzoyl)amino]-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C(=O)OC(C)(C)C)CC3)c(C(F)(F)F)c2)cc1I |
| InChI | InChI=1S/C25H29F3IN3O3/c1-16-5-6-17(13-21(16)29)22(33)30-19-8-7-18(20(14-19)25(26,27)28)15-31-9-11-32(12-10-31)23(34)35-24(2,3)4/h5-8,13-14H,9-12,15H2,1-4H3,(H,30,33) |
| InChIKey | HMSNRBSAFRAYLJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.42 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|