C29H40F3N3O3 — CID 143179732
3,4-dimethyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide;4,4,5,5-tetramethyl-1,3-dioxolane (PubChem CID 143179732) has the molecular formula C29H40F3N3O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is 3,4-dimethyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide;4,4,5,5-tetramethyl-1,3-dioxolane.
| Compound Name | 3,4-dimethyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide;4,4,5,5-tetramethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 143179732 |
| Molecular Formula | C29H40F3N3O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | 3,4-dimethyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide;4,4,5,5-tetramethyl-1,3-dioxolane |
| SMILES | CC1(C)OCOC1(C)C.Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C22H26F3N3O.C7H14O2/c1-15-4-5-17(12-16(15)2)21(29)26-19-7-6-18(20(13-19)22(23,24)25)14-28-10-8-27(3)9-11-28;1-6(2)7(3,4)9-5-8-6/h4-7,12-13H,8-11,14H2,1-3H3,(H,26,29);5H2,1-4H3 |
| InChIKey | ZKBSDCUHBAPPDC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |