C15H18F3N5O — CID 154116079
4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzoyl azide (PubChem CID 154116079) has the molecular formula C15H18F3N5O and a molecular weight of 341.34 g/mol. Its IUPAC name is 4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzoyl azide.
| Compound Name | 4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzoyl azide |
|---|---|
| PubChem CID | 154116079 |
| Molecular Formula | C15H18F3N5O |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)benzoyl azide |
| SMILES | CCN1CCN(Cc2ccc(C(=O)N=[N+]=[N-])cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H18F3N5O/c1-2-22-5-7-23(8-6-22)10-12-4-3-11(14(24)20-21-19)9-13(12)15(16,17)18/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | BJCOFHSKICIYCS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|