C24H27F3IN3O3 — CID 90133857
2-[4-[[4-[[2-(3-iodophenyl)acetyl]amino]-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethyl acetate (PubChem CID 90133857) has the molecular formula C24H27F3IN3O3 and a molecular weight of 589.40 g/mol. Its IUPAC name is 2-[4-[[4-[[2-(3-iodophenyl)acetyl]amino]-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethyl acetate.
| Compound Name | 2-[4-[[4-[[2-(3-iodophenyl)acetyl]amino]-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 90133857 |
| Molecular Formula | C24H27F3IN3O3 |
| Molecular Weight | 589.40 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | 2-[4-[[4-[[2-(3-iodophenyl)acetyl]amino]-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCN1CCN(Cc2ccc(NC(=O)Cc3cccc(I)c3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H27F3IN3O3/c1-17(32)34-12-11-30-7-9-31(10-8-30)16-19-5-6-21(15-22(19)24(25,26)27)29-23(33)14-18-3-2-4-20(28)13-18/h2-6,13,15H,7-12,14,16H2,1H3,(H,29,33) |
| InChIKey | IOGUEVCSOVLRHN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|