C22H25F3IN3O — CID 118451883
N-[3-[(4-ethylpiperazin-1-yl)methyl]-4-(trifluoromethyl)phenyl]-2-(3-iodophenyl)acetamide (PubChem CID 118451883) has the molecular formula C22H25F3IN3O and a molecular weight of 531.36 g/mol. Its IUPAC name is N-[3-[(4-ethylpiperazin-1-yl)methyl]-4-(trifluoromethyl)phenyl]-2-(3-iodophenyl)acetamide.
| Compound Name | N-[3-[(4-ethylpiperazin-1-yl)methyl]-4-(trifluoromethyl)phenyl]-2-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 118451883 |
| Molecular Formula | C22H25F3IN3O |
| Molecular Weight | 531.36 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | N-[3-[(4-ethylpiperazin-1-yl)methyl]-4-(trifluoromethyl)phenyl]-2-(3-iodophenyl)acetamide |
| SMILES | CCN1CCN(Cc2cc(NC(=O)Cc3cccc(I)c3)ccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H25F3IN3O/c1-2-28-8-10-29(11-9-28)15-17-14-19(6-7-20(17)22(23,24)25)27-21(30)13-16-4-3-5-18(26)12-16/h3-7,12,14H,2,8-11,13,15H2,1H3,(H,27,30) |
| InChIKey | NOWDCLPPNGROGV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|