C23H26F3IN4O — CID 140694667
N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-5-iodo-2,3-dihydroindole-1-carboxamide (PubChem CID 140694667) has the molecular formula C23H26F3IN4O and a molecular weight of 558.39 g/mol. Its IUPAC name is N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-5-iodo-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-5-iodo-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 140694667 |
| Molecular Formula | C23H26F3IN4O |
| Molecular Weight | 558.39 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-5-iodo-2,3-dihydroindole-1-carboxamide |
| SMILES | CCN1CCN(Cc2ccc(NC(=O)N3CCc4cc(I)ccc43)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H26F3IN4O/c1-2-29-9-11-30(12-10-29)15-17-3-5-19(14-20(17)23(24,25)26)28-22(32)31-8-7-16-13-18(27)4-6-21(16)31/h3-6,13-14H,2,7-12,15H2,1H3,(H,28,32) |
| InChIKey | QWEAMGYXILFWLW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|