C27H35BF3N3O4 — CID 144640753
N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide (PubChem CID 144640753) has the molecular formula C27H35BF3N3O4 and a molecular weight of 533.40 g/mol. Its IUPAC name is N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide.
| Compound Name | N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 144640753 |
| Molecular Formula | C27H35BF3N3O4 |
| Molecular Weight | 533.40 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)COc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C27H35BF3N3O4/c1-25(2)26(3,4)38-28(37-25)20-7-10-22(11-8-20)36-18-24(35)32-21-9-6-19(23(16-21)27(29,30)31)17-34-14-12-33(5)13-15-34/h6-11,16H,12-15,17-18H2,1-5H3,(H,32,35) |
| InChIKey | XIMXYBNGFRBPII-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|