C26H31F3N4O2 — CID 144640729
N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-2-[4-[(Z)-1-iminobut-2-en-2-yl]phenoxy]acetamide (PubChem CID 144640729) has the molecular formula C26H31F3N4O2 and a molecular weight of 488.55 g/mol. Its IUPAC name is N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-2-[4-[(Z)-1-iminobut-2-en-2-yl]phenoxy]acetamide.
| Compound Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-2-[4-[(Z)-1-iminobut-2-en-2-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 144640729 |
| Molecular Formula | C26H31F3N4O2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-2-[4-[(Z)-1-iminobut-2-en-2-yl]phenoxy]acetamide |
| SMILES | [H]/N=C/C(=C\C)c1ccc(OCC(=O)Nc2ccc(CN3CCN(CC)CC3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C26H31F3N4O2/c1-3-19(16-30)20-6-9-23(10-7-20)35-18-25(34)31-22-8-5-21(24(15-22)26(27,28)29)17-33-13-11-32(4-2)12-14-33/h3,5-10,15-16,30H,4,11-14,17-18H2,1-2H3,(H,31,34)/b19-3+,30-16+ |
| InChIKey | NSHOUSXSBQUDDZ-UWBMIACSSA-N |
| XLogP | 4.91 |
| TPSA | 68.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|