C16H25F3N3O+ — CID 162434873
methoxy-[4-[(4-propylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]azanium (PubChem CID 162434873) has the molecular formula C16H25F3N3O+ and a molecular weight of 332.39 g/mol. Its IUPAC name is methoxy-[4-[(4-propylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]azanium.
| Compound Name | methoxy-[4-[(4-propylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 162434873 |
| Molecular Formula | C16H25F3N3O+ |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | methoxy-[4-[(4-propylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]azanium |
| SMILES | CCCN1CCN(Cc2ccc([NH2+]OC)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H24F3N3O/c1-3-6-21-7-9-22(10-8-21)12-13-4-5-14(20-23-2)11-15(13)16(17,18)19/h4-5,11,20H,3,6-10,12H2,1-2H3/p+1 |
| InChIKey | IUAOEZWHZQGCHR-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 32.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|