C14H18F3NO — CID 157042080
4-[[4-ethyl-2-(trifluoromethyl)phenyl]methyl]morpholine (PubChem CID 157042080) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 4-[[4-ethyl-2-(trifluoromethyl)phenyl]methyl]morpholine.
| Compound Name | 4-[[4-ethyl-2-(trifluoromethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 157042080 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-[[4-ethyl-2-(trifluoromethyl)phenyl]methyl]morpholine |
| SMILES | CCc1ccc(CN2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NO/c1-2-11-3-4-12(13(9-11)14(15,16)17)10-18-5-7-19-8-6-18/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | PZMPUHPBLCTBBD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |