C15H22F3NO — CID 144816585
ethane;4-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]morpholine (PubChem CID 144816585) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is ethane;4-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]morpholine.
| Compound Name | ethane;4-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 144816585 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethane;4-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]morpholine |
| SMILES | CC.Cc1ccc(CN2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO.C2H6/c1-10-2-3-11(12(8-10)13(14,15)16)9-17-4-6-18-7-5-17;1-2/h2-3,8H,4-7,9H2,1H3;1-2H3 |
| InChIKey | IRTLKDMVGXNGAP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |