C19H26F3N3O2 — CID 70672221
1-[4-[4-ethyl-2-(trifluoromethyl)phenyl]piperazin-1-yl]-2-morpholin-4-ylethanone (PubChem CID 70672221) has the molecular formula C19H26F3N3O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 1-[4-[4-ethyl-2-(trifluoromethyl)phenyl]piperazin-1-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[4-[4-ethyl-2-(trifluoromethyl)phenyl]piperazin-1-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 70672221 |
| Molecular Formula | C19H26F3N3O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[4-[4-ethyl-2-(trifluoromethyl)phenyl]piperazin-1-yl]-2-morpholin-4-ylethanone |
| SMILES | CCc1ccc(N2CCN(C(=O)CN3CCOCC3)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H26F3N3O2/c1-2-15-3-4-17(16(13-15)19(20,21)22)24-5-7-25(8-6-24)18(26)14-23-9-11-27-12-10-23/h3-4,13H,2,5-12,14H2,1H3 |
| InChIKey | URVYIKNNSKWJBN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |