C21H30F3N3O2 — CID 91651791
2-morpholin-4-yl-1-[4-[4-[3-(trifluoromethyl)phenyl]butyl]piperazin-1-yl]ethanone (PubChem CID 91651791) has the molecular formula C21H30F3N3O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-morpholin-4-yl-1-[4-[4-[3-(trifluoromethyl)phenyl]butyl]piperazin-1-yl]ethanone.
| Compound Name | 2-morpholin-4-yl-1-[4-[4-[3-(trifluoromethyl)phenyl]butyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 91651791 |
| Molecular Formula | C21H30F3N3O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 2-morpholin-4-yl-1-[4-[4-[3-(trifluoromethyl)phenyl]butyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCOCC1)N1CCN(CCCCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H30F3N3O2/c22-21(23,24)19-6-3-5-18(16-19)4-1-2-7-25-8-10-27(11-9-25)20(28)17-26-12-14-29-15-13-26/h3,5-6,16H,1-2,4,7-15,17H2 |
| InChIKey | NPORRCLUELBBDB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|