C18H26F3N3O — CID 70382376
N-ethyl-4-[4-[3-(trifluoromethyl)phenyl]butyl]piperazine-1-carboxamide (PubChem CID 70382376) has the molecular formula C18H26F3N3O and a molecular weight of 357.42 g/mol. Its IUPAC name is N-ethyl-4-[4-[3-(trifluoromethyl)phenyl]butyl]piperazine-1-carboxamide.
| Compound Name | N-ethyl-4-[4-[3-(trifluoromethyl)phenyl]butyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70382376 |
| Molecular Formula | C18H26F3N3O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | N-ethyl-4-[4-[3-(trifluoromethyl)phenyl]butyl]piperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(CCCCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H26F3N3O/c1-2-22-17(25)24-12-10-23(11-13-24)9-4-3-6-15-7-5-8-16(14-15)18(19,20)21/h5,7-8,14H,2-4,6,9-13H2,1H3,(H,22,25) |
| InChIKey | ZGKSQLALFKSUQD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|