C17H27ClFN3O — CID 70476620
N-ethyl-4-[4-(4-fluorophenyl)butyl]piperazine-1-carboxamide;hydrochloride (PubChem CID 70476620) has the molecular formula C17H27ClFN3O and a molecular weight of 343.87 g/mol. Its IUPAC name is N-ethyl-4-[4-(4-fluorophenyl)butyl]piperazine-1-carboxamide;hydrochloride.
| Compound Name | N-ethyl-4-[4-(4-fluorophenyl)butyl]piperazine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70476620 |
| Molecular Formula | C17H27ClFN3O |
| Molecular Weight | 343.87 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-ethyl-4-[4-(4-fluorophenyl)butyl]piperazine-1-carboxamide;hydrochloride |
| SMILES | CCNC(=O)N1CCN(CCCCc2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C17H26FN3O.ClH/c1-2-19-17(22)21-13-11-20(12-14-21)10-4-3-5-15-6-8-16(18)9-7-15;/h6-9H,2-5,10-14H2,1H3,(H,19,22);1H |
| InChIKey | HPPWFVKHSWVKDX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.87 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|