C21H25ClFN3O — CID 113109096
N-[2-(4-chlorophenyl)ethyl]-4-[2-(4-fluorophenyl)ethyl]piperazine-1-carboxamide (PubChem CID 113109096) has the molecular formula C21H25ClFN3O and a molecular weight of 389.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-[2-(4-fluorophenyl)ethyl]piperazine-1-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-[2-(4-fluorophenyl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113109096 |
| Molecular Formula | C21H25ClFN3O |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-[2-(4-fluorophenyl)ethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)N1CCN(CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H25ClFN3O/c22-19-5-1-17(2-6-19)9-11-24-21(27)26-15-13-25(14-16-26)12-10-18-3-7-20(23)8-4-18/h1-8H,9-16H2,(H,24,27) |
| InChIKey | RSSYGDUTOXROQI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |