C23H28F3NO3 — CID 170870404
4-[3-[3-ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propyl]morpholine (PubChem CID 170870404) has the molecular formula C23H28F3NO3 and a molecular weight of 423.48 g/mol. Its IUPAC name is 4-[3-[3-ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propyl]morpholine.
| Compound Name | 4-[3-[3-ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propyl]morpholine |
|---|---|
| PubChem CID | 170870404 |
| Molecular Formula | C23H28F3NO3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 4-[3-[3-ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propyl]morpholine |
| SMILES | CCOc1cc(CCCN2CCOCC2)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H28F3NO3/c1-2-29-22-16-18(6-4-10-27-11-13-28-14-12-27)8-9-21(22)30-17-19-5-3-7-20(15-19)23(24,25)26/h3,5,7-9,15-16H,2,4,6,10-14,17H2,1H3 |
| InChIKey | NZWYGASSYHDLPJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |