C17H26ClNO3 — CID 170869317
4-[3-[4-(3-chloropropoxy)-3-methoxyphenyl]propyl]morpholine (PubChem CID 170869317) has the molecular formula C17H26ClNO3 and a molecular weight of 327.85 g/mol. Its IUPAC name is 4-[3-[4-(3-chloropropoxy)-3-methoxyphenyl]propyl]morpholine.
| Compound Name | 4-[3-[4-(3-chloropropoxy)-3-methoxyphenyl]propyl]morpholine |
|---|---|
| PubChem CID | 170869317 |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-[3-[4-(3-chloropropoxy)-3-methoxyphenyl]propyl]morpholine |
| SMILES | COc1cc(CCCN2CCOCC2)ccc1OCCCCl |
| InChI | InChI=1S/C17H26ClNO3/c1-20-17-14-15(5-6-16(17)22-11-3-7-18)4-2-8-19-9-12-21-13-10-19/h5-6,14H,2-4,7-13H2,1H3 |
| InChIKey | GDQCWFUAFURELI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|